C21H22ClN3O4S2 — CID 53120059
6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-pentylpyridine-3-carboxamide (PubChem CID 53120059) has the molecular formula C21H22ClN3O4S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-pentylpyridine-3-carboxamide.
| Compound Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120059 |
| Molecular Formula | C21H22ClN3O4S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenoxy]-N-pentylpyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)nc1 |
| InChI | InChI=1S/C21H22ClN3O4S2/c1-2-3-4-13-23-21(26)15-5-11-19(24-14-15)29-17-8-6-16(7-9-17)25-31(27,28)20-12-10-18(22)30-20/h5-12,14,25H,2-4,13H2,1H3,(H,23,26) |
| InChIKey | JSVDHLAEIYFHQY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|