C15H14ClN5O3S2 — CID 154836612
4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-[(2-methyltriazol-4-yl)methyl]benzamide (PubChem CID 154836612) has the molecular formula C15H14ClN5O3S2 and a molecular weight of 411.90 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-[(2-methyltriazol-4-yl)methyl]benzamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-[(2-methyltriazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 154836612 |
| Molecular Formula | C15H14ClN5O3S2 |
| Molecular Weight | 411.90 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-[(2-methyltriazol-4-yl)methyl]benzamide |
| SMILES | Cn1ncc(CNC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)n1 |
| InChI | InChI=1S/C15H14ClN5O3S2/c1-21-18-9-12(19-21)8-17-15(22)10-2-4-11(5-3-10)20-26(23,24)14-7-6-13(16)25-14/h2-7,9,20H,8H2,1H3,(H,17,22) |
| InChIKey | SJBXJLLOVSZQSK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |