C19H16ClN3O3S3 — CID 46388198
6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 46388198) has the molecular formula C19H16ClN3O3S3 and a molecular weight of 466.01 g/mol. Its IUPAC name is 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388198 |
| Molecular Formula | C19H16ClN3O3S3 |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 6-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Sc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)nc1 |
| InChI | InChI=1S/C19H16ClN3O3S3/c1-2-11-21-19(24)13-3-9-17(22-12-13)27-15-6-4-14(5-7-15)23-29(25,26)18-10-8-16(20)28-18/h2-10,12,23H,1,11H2,(H,21,24) |
| InChIKey | MLXNMBHKHIJKAU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|