C16H17N3O3S2 — CID 46388193
6-[4-(methanesulfonamido)phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 46388193) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 6-[4-(methanesulfonamido)phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[4-(methanesulfonamido)phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388193 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 6-[4-(methanesulfonamido)phenyl]sulfanyl-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Sc2ccc(NS(C)(=O)=O)cc2)nc1 |
| InChI | InChI=1S/C16H17N3O3S2/c1-3-10-17-16(20)12-4-9-15(18-11-12)23-14-7-5-13(6-8-14)19-24(2,21)22/h3-9,11,19H,1,10H2,2H3,(H,17,20) |
| InChIKey | BDKXUYVRCVMULS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|