C23H25N3O3S2 — CID 46388101
N-butan-2-yl-6-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide (PubChem CID 46388101) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-butan-2-yl-6-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-butan-2-yl-6-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388101 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-butan-2-yl-6-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(Sc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)nc1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-4-17(3)25-23(27)18-7-14-22(24-15-18)30-20-10-8-19(9-11-20)26-31(28,29)21-12-5-16(2)6-13-21/h5-15,17,26H,4H2,1-3H3,(H,25,27) |
| InChIKey | CLNPHRWFNRBPMI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |