C22H23N3O4S2 — CID 46388212
6-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(3-methoxypropyl)pyridine-3-carboxamide (PubChem CID 46388212) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 6-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(3-methoxypropyl)pyridine-3-carboxamide.
| Compound Name | 6-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(3-methoxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388212 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 6-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(3-methoxypropyl)pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(Sc2ccc(NS(=O)(=O)c3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-29-15-5-14-23-22(26)17-8-13-21(24-16-17)30-19-11-9-18(10-12-19)25-31(27,28)20-6-3-2-4-7-20/h2-4,6-13,16,25H,5,14-15H2,1H3,(H,23,26) |
| InChIKey | XIQRCZLZMNZZRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|