C23H25N3O4S2 — CID 46388221
N-(3-methoxypropyl)-6-[4-[(2-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide (PubChem CID 46388221) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(3-methoxypropyl)-6-[4-[(2-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide.
| Compound Name | N-(3-methoxypropyl)-6-[4-[(2-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46388221 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-(3-methoxypropyl)-6-[4-[(2-methylphenyl)sulfonylamino]phenyl]sulfanylpyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(Sc2ccc(NS(=O)(=O)c3ccccc3C)cc2)nc1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-17-6-3-4-7-21(17)32(28,29)26-19-9-11-20(12-10-19)31-22-13-8-18(16-25-22)23(27)24-14-5-15-30-2/h3-4,6-13,16,26H,5,14-15H2,1-2H3,(H,24,27) |
| InChIKey | RSSOVJQSYSROLB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|