C12H12ClN3O2S2 — CID 113009417
5-chloro-N-[6-(prop-2-enylamino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113009417) has the molecular formula C12H12ClN3O2S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 5-chloro-N-[6-(prop-2-enylamino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[6-(prop-2-enylamino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113009417 |
| Molecular Formula | C12H12ClN3O2S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-chloro-N-[6-(prop-2-enylamino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C12H12ClN3O2S2/c1-2-7-14-11-5-3-9(8-15-11)16-20(17,18)12-6-4-10(13)19-12/h2-6,8,16H,1,7H2,(H,14,15) |
| InChIKey | PSLYNZAUFCLJET-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|