C17H21N3O3S — CID 113009412
2-methoxy-4,5-dimethyl-N-[6-(prop-2-enylamino)-3-pyridinyl]benzenesulfonamide (PubChem CID 113009412) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-N-[6-(prop-2-enylamino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2-methoxy-4,5-dimethyl-N-[6-(prop-2-enylamino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113009412 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-N-[6-(prop-2-enylamino)-3-pyridinyl]benzenesulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2cc(C)c(C)cc2OC)cn1 |
| InChI | InChI=1S/C17H21N3O3S/c1-5-8-18-17-7-6-14(11-19-17)20-24(21,22)16-10-13(3)12(2)9-15(16)23-4/h5-7,9-11,20H,1,8H2,2-4H3,(H,18,19) |
| InChIKey | NYUKUUWJXIMNSR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|