C16H19N3O2S — CID 113023907
2,4-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113023907) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2,4-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113023907 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2,4-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc(C)cc2C)nc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-4-9-17-14-6-8-16(18-11-14)19-22(20,21)15-7-5-12(2)10-13(15)3/h4-8,10-11,17H,1,9H2,2-3H3,(H,18,19) |
| InChIKey | WNZOQJDXJPUTNJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|