C21H24N4O2S — CID 113020920
N-[6-[4-(dimethylamino)anilino]-3-pyridinyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 113020920) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[6-[4-(dimethylamino)anilino]-3-pyridinyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[6-[4-(dimethylamino)anilino]-3-pyridinyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113020920 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[6-[4-(dimethylamino)anilino]-3-pyridinyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3ccc(N(C)C)cc3)nc2)c(C)c1 |
| InChI | InChI=1S/C21H24N4O2S/c1-15-5-11-20(16(2)13-15)28(26,27)24-18-8-12-21(22-14-18)23-17-6-9-19(10-7-17)25(3)4/h5-14,24H,1-4H3,(H,22,23) |
| InChIKey | RMMLSFYEXHXAJR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|