C13H17N5O2S — CID 113023941
3,5-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]-1H-pyrazole-4-sulfonamide (PubChem CID 113023941) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3,5-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113023941 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3,5-dimethyl-N-[5-(prop-2-enylamino)-2-pyridinyl]-1H-pyrazole-4-sulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2c(C)n[nH]c2C)nc1 |
| InChI | InChI=1S/C13H17N5O2S/c1-4-7-14-11-5-6-12(15-8-11)18-21(19,20)13-9(2)16-17-10(13)3/h4-6,8,14H,1,7H2,2-3H3,(H,15,18)(H,16,17) |
| InChIKey | VWPQMHCMJDPMOR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|