C13H19N5O3S — CID 113010431
N-[6-(2-methoxyethylamino)-3-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 113010431) has the molecular formula C13H19N5O3S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[6-(2-methoxyethylamino)-3-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[6-(2-methoxyethylamino)-3-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113010431 |
| Molecular Formula | C13H19N5O3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[6-(2-methoxyethylamino)-3-pyridinyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | COCCNc1ccc(NS(=O)(=O)c2c(C)n[nH]c2C)cn1 |
| InChI | InChI=1S/C13H19N5O3S/c1-9-13(10(2)17-16-9)22(19,20)18-11-4-5-12(15-8-11)14-6-7-21-3/h4-5,8,18H,6-7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | KCDDDVHGCNOEKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|