C9H15N3O3S — CID 113025091
N-[5-(2-methoxyethylamino)-2-pyridinyl]methanesulfonamide (PubChem CID 113025091) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[5-(2-methoxyethylamino)-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-(2-methoxyethylamino)-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 113025091 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-[5-(2-methoxyethylamino)-2-pyridinyl]methanesulfonamide |
| SMILES | COCCNc1ccc(NS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C9H15N3O3S/c1-15-6-5-10-8-3-4-9(11-7-8)12-16(2,13)14/h3-4,7,10H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | MYSTWCDSZZZVPT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|