C8H14N4O — CID 55281043
5-hydrazinyl-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 55281043) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | 5-hydrazinyl-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55281043 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-hydrazinyl-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | COCCNc1ccc(NN)cn1 |
| InChI | InChI=1S/C8H14N4O/c1-13-5-4-10-8-3-2-7(12-9)6-11-8/h2-3,6,12H,4-5,9H2,1H3,(H,10,11) |
| InChIKey | DELIWDPKENTTQK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|