C10H19N3O — CID 160536663
5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;methane (PubChem CID 160536663) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;methane.
| Compound Name | 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;methane |
|---|---|
| PubChem CID | 160536663 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;methane |
| SMILES | C.COCCNc1ccc(CN)cn1 |
| InChI | InChI=1S/C9H15N3O.CH4/c1-13-5-4-11-9-3-2-8(6-10)7-12-9;/h2-3,7H,4-6,10H2,1H3,(H,11,12);1H4 |
| InChIKey | QWFZDXAQMIWPBK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|