C9H17Cl2N3O — CID 162339864
5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;dihydrochloride (PubChem CID 162339864) has the molecular formula C9H17Cl2N3O and a molecular weight of 254.16 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;dihydrochloride.
| Compound Name | 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 162339864 |
| Molecular Formula | C9H17Cl2N3O |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxyethyl)pyridin-2-amine;dihydrochloride |
| SMILES | COCCNc1ccc(CN)cn1.Cl.Cl |
| InChI | InChI=1S/C9H15N3O.2ClH/c1-13-5-4-11-9-3-2-8(6-10)7-12-9;;/h2-3,7H,4-6,10H2,1H3,(H,11,12);2*1H |
| InChIKey | ZGCWFJGYUGNINE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|