C8H14N4O3S — CID 113039467
N-[6-(2-methoxyethylamino)pyridazin-3-yl]methanesulfonamide (PubChem CID 113039467) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-[6-(2-methoxyethylamino)pyridazin-3-yl]methanesulfonamide.
| Compound Name | N-[6-(2-methoxyethylamino)pyridazin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113039467 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[6-(2-methoxyethylamino)pyridazin-3-yl]methanesulfonamide |
| SMILES | COCCNc1ccc(NS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C8H14N4O3S/c1-15-6-5-9-7-3-4-8(11-10-7)12-16(2,13)14/h3-4H,5-6H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | ZTRKOPLXJDCTKM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|