C17H24N4O4S — CID 113039614
2-methoxy-N-[6-(3-methoxypropylamino)pyridazin-3-yl]-4,5-dimethylbenzenesulfonamide (PubChem CID 113039614) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-methoxy-N-[6-(3-methoxypropylamino)pyridazin-3-yl]-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-[6-(3-methoxypropylamino)pyridazin-3-yl]-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113039614 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-methoxy-N-[6-(3-methoxypropylamino)pyridazin-3-yl]-4,5-dimethylbenzenesulfonamide |
| SMILES | COCCCNc1ccc(NS(=O)(=O)c2cc(C)c(C)cc2OC)nn1 |
| InChI | InChI=1S/C17H24N4O4S/c1-12-10-14(25-4)15(11-13(12)2)26(22,23)21-17-7-6-16(19-20-17)18-8-5-9-24-3/h6-7,10-11H,5,8-9H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | NOKOMFNCROBYBW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|