C15H18N4O5S — CID 113039612
N-[6-(3-methoxypropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 113039612) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[6-(3-methoxypropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[6-(3-methoxypropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 113039612 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[6-(3-methoxypropylamino)pyridazin-3-yl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | COCCCNc1ccc(NS(=O)(=O)c2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C15H18N4O5S/c1-22-8-2-7-16-14-5-6-15(18-17-14)19-25(20,21)11-3-4-12-13(9-11)24-10-23-12/h3-6,9H,2,7-8,10H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | FMTWNYASIUDGMN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|