C10H13NO6S — CID 110642725
N-(2-methoxyethoxy)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110642725) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(2-methoxyethoxy)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110642725 |
| Molecular Formula | C10H13NO6S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-(2-methoxyethoxy)-1,3-benzodioxole-5-sulfonamide |
| SMILES | COCCONS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO6S/c1-14-4-5-17-11-18(12,13)8-2-3-9-10(6-8)16-7-15-9/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | DSCMHKHHANHWMX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|