C17H22N4O4S — CID 113044728
N-[6-(pentylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 113044728) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[6-(pentylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[6-(pentylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 113044728 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[6-(pentylamino)pyridazin-3-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCCCCNc1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)nn1 |
| InChI | InChI=1S/C17H22N4O4S/c1-2-3-4-9-18-16-7-8-17(20-19-16)21-26(22,23)13-5-6-14-15(12-13)25-11-10-24-14/h5-8,12H,2-4,9-11H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | PPCIWOVVZTZZRY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|