C15H19N3O4S — CID 126789295
N-(5-butyl-1H-pyrazol-3-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 126789295) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(5-butyl-1H-pyrazol-3-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(5-butyl-1H-pyrazol-3-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 126789295 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(5-butyl-1H-pyrazol-3-yl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCCCc1cc(NS(=O)(=O)c2ccc3c(c2)OCCO3)n[nH]1 |
| InChI | InChI=1S/C15H19N3O4S/c1-2-3-4-11-9-15(17-16-11)18-23(19,20)12-5-6-13-14(10-12)22-8-7-21-13/h5-6,9-10H,2-4,7-8H2,1H3,(H2,16,17,18) |
| InChIKey | JOQDGSHQVGFROA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |