C18H23N5O3S — CID 113044741
1-methyl-2-oxo-N-[6-(pentylamino)pyridazin-3-yl]-3H-indole-5-sulfonamide (PubChem CID 113044741) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[6-(pentylamino)pyridazin-3-yl]-3H-indole-5-sulfonamide.
| Compound Name | 1-methyl-2-oxo-N-[6-(pentylamino)pyridazin-3-yl]-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 113044741 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-methyl-2-oxo-N-[6-(pentylamino)pyridazin-3-yl]-3H-indole-5-sulfonamide |
| SMILES | CCCCCNc1ccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3C)nn1 |
| InChI | InChI=1S/C18H23N5O3S/c1-3-4-5-10-19-16-8-9-17(21-20-16)22-27(25,26)14-6-7-15-13(11-14)12-18(24)23(15)2/h6-9,11H,3-5,10,12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | MEIOTFNMPNVKGV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|