C14H17FN4O2S — CID 16942060
N-[6-(butylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 16942060) has the molecular formula C14H17FN4O2S and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[6-(butylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[6-(butylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16942060 |
| Molecular Formula | C14H17FN4O2S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[6-(butylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | CCCCNc1ccc(NS(=O)(=O)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C14H17FN4O2S/c1-2-3-10-16-13-8-9-14(18-17-13)19-22(20,21)12-6-4-11(15)5-7-12/h4-9H,2-3,10H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | GKWNUIWUJFYKGR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|