C16H20ClN3O2S — CID 113030458
4-chloro-N-[5-(pentylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113030458) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 4-chloro-N-[5-(pentylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-(pentylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113030458 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-chloro-N-[5-(pentylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | CCCCCNc1ccc(NS(=O)(=O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-2-3-4-11-18-14-7-10-16(19-12-14)20-23(21,22)15-8-5-13(17)6-9-15/h5-10,12,18H,2-4,11H2,1H3,(H,19,20) |
| InChIKey | RBEMLNHLWHCDBY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|