C15H21N3O2S2 — CID 113030482
5-methyl-N-[5-(pentylamino)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113030482) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 5-methyl-N-[5-(pentylamino)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[5-(pentylamino)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113030482 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-methyl-N-[5-(pentylamino)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CCCCCNc1ccc(NS(=O)(=O)c2ccc(C)s2)nc1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-3-4-5-10-16-13-7-8-14(17-11-13)18-22(19,20)15-9-6-12(2)21-15/h6-9,11,16H,3-5,10H2,1-2H3,(H,17,18) |
| InChIKey | KXXCZMPFLSVYNE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|