C15H21N3O2S2 — CID 113030356
5-methyl-N-[5-(3-methylbutylamino)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113030356) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 5-methyl-N-[5-(3-methylbutylamino)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[5-(3-methylbutylamino)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113030356 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-methyl-N-[5-(3-methylbutylamino)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NCCC(C)C)cn2)s1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-11(2)8-9-16-13-5-6-14(17-10-13)18-22(19,20)15-7-4-12(3)21-15/h4-7,10-11,16H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | AUAQIZHFCIUHMY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |