C16H16N4O2S2 — CID 113027958
5-methyl-N-[5-(pyridin-4-ylmethylamino)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113027958) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-methyl-N-[5-(pyridin-4-ylmethylamino)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[5-(pyridin-4-ylmethylamino)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113027958 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 5-methyl-N-[5-(pyridin-4-ylmethylamino)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NCc3ccncc3)cn2)s1 |
| InChI | InChI=1S/C16H16N4O2S2/c1-12-2-5-16(23-12)24(21,22)20-15-4-3-14(11-19-15)18-10-13-6-8-17-9-7-13/h2-9,11,18H,10H2,1H3,(H,19,20) |
| InChIKey | WZCRDXOFHJBJOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |