C16H14FN3O2S2 — CID 113035942
N-[5-(3-fluoroanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide (PubChem CID 113035942) has the molecular formula C16H14FN3O2S2 and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[5-(3-fluoroanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[5-(3-fluoroanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113035942 |
| Molecular Formula | C16H14FN3O2S2 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[5-(3-fluoroanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cccc(F)c3)cn2)s1 |
| InChI | InChI=1S/C16H14FN3O2S2/c1-11-5-8-16(23-11)24(21,22)20-15-7-6-14(10-18-15)19-13-4-2-3-12(17)9-13/h2-10,19H,1H3,(H,18,20) |
| InChIKey | VOCCQAFUMPAEGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |