C18H19N3O2S2 — CID 113032078
N-[5-(2,5-dimethylanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide (PubChem CID 113032078) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[5-(2,5-dimethylanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[5-(2,5-dimethylanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113032078 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[5-(2,5-dimethylanilino)-2-pyridinyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(C)c(Nc2ccc(NS(=O)(=O)c3ccc(C)s3)nc2)c1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-12-4-5-13(2)16(10-12)20-15-7-8-17(19-11-15)21-25(22,23)18-9-6-14(3)24-18/h4-11,20H,1-3H3,(H,19,21) |
| InChIKey | CVPITSRTSGQECL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |