C17H17N3O2S2 — CID 113011521
N-[6-(benzylamino)-3-pyridinyl]-5-methylthiophene-2-sulfonamide (PubChem CID 113011521) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[6-(benzylamino)-3-pyridinyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[6-(benzylamino)-3-pyridinyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113011521 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[6-(benzylamino)-3-pyridinyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NCc3ccccc3)nc2)s1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-13-7-10-17(23-13)24(21,22)20-15-8-9-16(19-12-15)18-11-14-5-3-2-4-6-14/h2-10,12,20H,11H2,1H3,(H,18,19) |
| InChIKey | WOQBSAGLAPKHQF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |