C19H21N3O2S2 — CID 113011834
5-ethyl-N-[6-[(4-methylphenyl)methylamino]-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113011834) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 5-ethyl-N-[6-[(4-methylphenyl)methylamino]-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[6-[(4-methylphenyl)methylamino]-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113011834 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-ethyl-N-[6-[(4-methylphenyl)methylamino]-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(NCc3ccc(C)cc3)nc2)s1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-3-17-9-11-19(25-17)26(23,24)22-16-8-10-18(21-13-16)20-12-15-6-4-14(2)5-7-15/h4-11,13,22H,3,12H2,1-2H3,(H,20,21) |
| InChIKey | FJUKXHUCDDDKKR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |