C19H21N3O2S2 — CID 113017331
N-[6-(2,3-dimethylanilino)-3-pyridinyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 113017331) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-[6-(2,3-dimethylanilino)-3-pyridinyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[6-(2,3-dimethylanilino)-3-pyridinyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113017331 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[6-(2,3-dimethylanilino)-3-pyridinyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(Nc3cccc(C)c3C)nc2)s1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-4-16-9-11-19(25-16)26(23,24)22-15-8-10-18(20-12-15)21-17-7-5-6-13(2)14(17)3/h5-12,22H,4H2,1-3H3,(H,20,21) |
| InChIKey | KNCBRBLANQZFRI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |