C16H20ClN3O2S — CID 113030332
4-chloro-N-[5-(3-methylbutylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113030332) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 4-chloro-N-[5-(3-methylbutylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-(3-methylbutylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113030332 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-chloro-N-[5-(3-methylbutylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | CC(C)CCNc1ccc(NS(=O)(=O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-12(2)9-10-18-14-5-8-16(19-11-14)20-23(21,22)15-6-3-13(17)4-7-15/h3-8,11-12,18H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | DQYBMJAZUNSEII-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |