C14H19N3O2S2 — CID 113015165
N-[6-(3-methylbutylamino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113015165) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[6-(3-methylbutylamino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-methylbutylamino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113015165 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[6-(3-methylbutylamino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | CC(C)CCNc1ccc(NS(=O)(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-11(2)7-8-15-13-6-5-12(10-16-13)17-21(18,19)14-4-3-9-20-14/h3-6,9-11,17H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | XPEQJQAFAJSNRX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |