C14H16ClN3O2S — CID 113023545
2-chloro-N-[5-(propylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113023545) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-chloro-N-[5-(propylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[5-(propylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113023545 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-chloro-N-[5-(propylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | CCCNc1ccc(NS(=O)(=O)c2ccccc2Cl)nc1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-2-9-16-11-7-8-14(17-10-11)18-21(19,20)13-6-4-3-5-12(13)15/h3-8,10,16H,2,9H2,1H3,(H,17,18) |
| InChIKey | VWEDKKMSVAXKFR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |