C18H15ClFN3O2S — CID 113012187
2-chloro-N-[6-[(4-fluorophenyl)methylamino]-3-pyridinyl]benzenesulfonamide (PubChem CID 113012187) has the molecular formula C18H15ClFN3O2S and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-chloro-N-[6-[(4-fluorophenyl)methylamino]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[6-[(4-fluorophenyl)methylamino]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113012187 |
| Molecular Formula | C18H15ClFN3O2S |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-chloro-N-[6-[(4-fluorophenyl)methylamino]-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NCc2ccc(F)cc2)nc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClFN3O2S/c19-16-3-1-2-4-17(16)26(24,25)23-15-9-10-18(22-12-15)21-11-13-5-7-14(20)8-6-13/h1-10,12,23H,11H2,(H,21,22) |
| InChIKey | WTWRRAIVXRHMLG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |