C14H17FN4O2S — CID 113012162
5-(dimethylsulfamoylamino)-2-[(4-fluorophenyl)methylamino]pyridine (PubChem CID 113012162) has the molecular formula C14H17FN4O2S and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-2-[(4-fluorophenyl)methylamino]pyridine.
| Compound Name | 5-(dimethylsulfamoylamino)-2-[(4-fluorophenyl)methylamino]pyridine |
|---|---|
| PubChem CID | 113012162 |
| Molecular Formula | C14H17FN4O2S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-2-[(4-fluorophenyl)methylamino]pyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(NCc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C14H17FN4O2S/c1-19(2)22(20,21)18-13-7-8-14(17-10-13)16-9-11-3-5-12(15)6-4-11/h3-8,10,18H,9H2,1-2H3,(H,16,17) |
| InChIKey | VOOFKMSYRWIZTO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |