C11H21N5O2S — CID 113025561
5-[2-(dimethylamino)ethylamino]-2-(dimethylsulfamoylamino)pyridine (PubChem CID 113025561) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylamino]-2-(dimethylsulfamoylamino)pyridine.
| Compound Name | 5-[2-(dimethylamino)ethylamino]-2-(dimethylsulfamoylamino)pyridine |
|---|---|
| PubChem CID | 113025561 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 5-[2-(dimethylamino)ethylamino]-2-(dimethylsulfamoylamino)pyridine |
| SMILES | CN(C)CCNc1ccc(NS(=O)(=O)N(C)C)nc1 |
| InChI | InChI=1S/C11H21N5O2S/c1-15(2)8-7-12-10-5-6-11(13-9-10)14-19(17,18)16(3)4/h5-6,9,12H,7-8H2,1-4H3,(H,13,14) |
| InChIKey | LORWGXZSLXVSSU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |