C8H14N4O2S — CID 115268515
5-(dimethylsulfamoylamino)-2-(methylamino)pyridine (PubChem CID 115268515) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-2-(methylamino)pyridine.
| Compound Name | 5-(dimethylsulfamoylamino)-2-(methylamino)pyridine |
|---|---|
| PubChem CID | 115268515 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-2-(methylamino)pyridine |
| SMILES | CNc1ccc(NS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C8H14N4O2S/c1-9-8-5-4-7(6-10-8)11-15(13,14)12(2)3/h4-6,11H,1-3H3,(H,9,10) |
| InChIKey | WFHIXBFTIJIJEX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |