C14H17BrN4O2S — CID 113021518
2-(4-bromo-2-methylanilino)-5-(dimethylsulfamoylamino)pyridine (PubChem CID 113021518) has the molecular formula C14H17BrN4O2S and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-(4-bromo-2-methylanilino)-5-(dimethylsulfamoylamino)pyridine.
| Compound Name | 2-(4-bromo-2-methylanilino)-5-(dimethylsulfamoylamino)pyridine |
|---|---|
| PubChem CID | 113021518 |
| Molecular Formula | C14H17BrN4O2S |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-(4-bromo-2-methylanilino)-5-(dimethylsulfamoylamino)pyridine |
| SMILES | Cc1cc(Br)ccc1Nc1ccc(NS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C14H17BrN4O2S/c1-10-8-11(15)4-6-13(10)17-14-7-5-12(9-16-14)18-22(20,21)19(2)3/h4-9,18H,1-3H3,(H,16,17) |
| InChIKey | CYPJTBKSYWYIHL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |