C16H22N4O2S — CID 113032840
2-(dimethylsulfamoylamino)-5-(2,4,6-trimethylanilino)pyridine (PubChem CID 113032840) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-5-(2,4,6-trimethylanilino)pyridine.
| Compound Name | 2-(dimethylsulfamoylamino)-5-(2,4,6-trimethylanilino)pyridine |
|---|---|
| PubChem CID | 113032840 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-5-(2,4,6-trimethylanilino)pyridine |
| SMILES | Cc1cc(C)c(Nc2ccc(NS(=O)(=O)N(C)C)nc2)c(C)c1 |
| InChI | InChI=1S/C16H22N4O2S/c1-11-8-12(2)16(13(3)9-11)18-14-6-7-15(17-10-14)19-23(21,22)20(4)5/h6-10,18H,1-5H3,(H,17,19) |
| InChIKey | CVXRRZYXJITFJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |