C21H23N3O3S — CID 113017943
4-methoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]benzenesulfonamide (PubChem CID 113017943) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-methoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113017943 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-methoxy-N-[6-(2,4,6-trimethylanilino)-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3c(C)cc(C)cc3C)nc2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-11-15(2)21(16(3)12-14)23-20-10-5-17(13-22-20)24-28(25,26)19-8-6-18(27-4)7-9-19/h5-13,24H,1-4H3,(H,22,23) |
| InChIKey | JCSLFLJFHJJTFO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |