C18H15F2N3O3S — CID 113037637
N-[5-(3,4-difluoroanilino)-2-pyridinyl]-4-methoxybenzenesulfonamide (PubChem CID 113037637) has the molecular formula C18H15F2N3O3S and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[5-(3,4-difluoroanilino)-2-pyridinyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113037637 |
| Molecular Formula | C18H15F2N3O3S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3ccc(F)c(F)c3)cn2)cc1 |
| InChI | InChI=1S/C18H15F2N3O3S/c1-26-14-4-6-15(7-5-14)27(24,25)23-18-9-3-13(11-21-18)22-12-2-8-16(19)17(20)10-12/h2-11,22H,1H3,(H,21,23) |
| InChIKey | DMGMUKMLVYNBFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |