C14H15F2N3O2S — CID 113037630
N-[5-(3,4-difluoroanilino)-2-pyridinyl]propane-1-sulfonamide (PubChem CID 113037630) has the molecular formula C14H15F2N3O2S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[5-(3,4-difluoroanilino)-2-pyridinyl]propane-1-sulfonamide.
| Compound Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113037630 |
| Molecular Formula | C14H15F2N3O2S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[5-(3,4-difluoroanilino)-2-pyridinyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(Nc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C14H15F2N3O2S/c1-2-7-22(20,21)19-14-6-4-11(9-17-14)18-10-3-5-12(15)13(16)8-10/h3-6,8-9,18H,2,7H2,1H3,(H,17,19) |
| InChIKey | XDDOAFKYXNELSM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |