C15H17F2N3O2S — CID 113023261
N-[6-(3,4-difluoroanilino)-3-pyridinyl]butane-1-sulfonamide (PubChem CID 113023261) has the molecular formula C15H17F2N3O2S and a molecular weight of 341.38 g/mol. Its IUPAC name is N-[6-(3,4-difluoroanilino)-3-pyridinyl]butane-1-sulfonamide.
| Compound Name | N-[6-(3,4-difluoroanilino)-3-pyridinyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113023261 |
| Molecular Formula | C15H17F2N3O2S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[6-(3,4-difluoroanilino)-3-pyridinyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(Nc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C15H17F2N3O2S/c1-2-3-8-23(21,22)20-12-5-7-15(18-10-12)19-11-4-6-13(16)14(17)9-11/h4-7,9-10,20H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | NPGJSXWEHWETLA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |