C18H15F2N3O2S — CID 113023281
N-[6-(3,4-difluoroanilino)-3-pyridinyl]-2-methylbenzenesulfonamide (PubChem CID 113023281) has the molecular formula C18H15F2N3O2S and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[6-(3,4-difluoroanilino)-3-pyridinyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[6-(3,4-difluoroanilino)-3-pyridinyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113023281 |
| Molecular Formula | C18H15F2N3O2S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[6-(3,4-difluoroanilino)-3-pyridinyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc(Nc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C18H15F2N3O2S/c1-12-4-2-3-5-17(12)26(24,25)23-14-7-9-18(21-11-14)22-13-6-8-15(19)16(20)10-13/h2-11,23H,1H3,(H,21,22) |
| InChIKey | XVZKRBYSNAUTAB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |