C16H22N4O3S — CID 113019877
5-(dimethylsulfamoylamino)-2-(2-propan-2-yloxyanilino)pyridine (PubChem CID 113019877) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-2-(2-propan-2-yloxyanilino)pyridine.
| Compound Name | 5-(dimethylsulfamoylamino)-2-(2-propan-2-yloxyanilino)pyridine |
|---|---|
| PubChem CID | 113019877 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-2-(2-propan-2-yloxyanilino)pyridine |
| SMILES | CC(C)Oc1ccccc1Nc1ccc(NS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C16H22N4O3S/c1-12(2)23-15-8-6-5-7-14(15)18-16-10-9-13(11-17-16)19-24(21,22)20(3)4/h5-12,19H,1-4H3,(H,17,18) |
| InChIKey | HDILHSZJJOXQJT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |