C16H19N3O3 — CID 113019866
methyl N-[6-(2-propan-2-yloxyanilino)-3-pyridinyl]carbamate (PubChem CID 113019866) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is methyl N-[6-(2-propan-2-yloxyanilino)-3-pyridinyl]carbamate.
| Compound Name | methyl N-[6-(2-propan-2-yloxyanilino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113019866 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | methyl N-[6-(2-propan-2-yloxyanilino)-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2ccccc2OC(C)C)nc1 |
| InChI | InChI=1S/C16H19N3O3/c1-11(2)22-14-7-5-4-6-13(14)19-15-9-8-12(10-17-15)18-16(20)21-3/h4-11H,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | BOUPIRBJBSIWAT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |